Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Bis(cyclopentadienyl)titanium dichloride, 97%
CAS: 1271-19-8 Molecular Formula: C10H10Cl2Ti-2 Molecular Weight (g/mol): 248.957 MDL Number: MFCD00003723 InChI Key: MKNXBRLZBFVUPV-UHFFFAOYSA-L Synonym: Dichlorobis(cyclopentadienyl)titanium; Titanocene dichloride PubChem CID: 124040768 IUPAC Name: cyclopenta-1,3-diene;titanium(2+);dichloride SMILES: [CH-]1C=CC=C1.[CH-]1C=CC=C1.[Cl-].[Cl-].[Ti+2]
| PubChem CID | 124040768 |
|---|---|
| CAS | 1271-19-8 |
| Molecular Weight (g/mol) | 248.957 |
| MDL Number | MFCD00003723 |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC=C1.[Cl-].[Cl-].[Ti+2] |
| Synonym | Dichlorobis(cyclopentadienyl)titanium; Titanocene dichloride |
| IUPAC Name | cyclopenta-1,3-diene;titanium(2+);dichloride |
| InChI Key | MKNXBRLZBFVUPV-UHFFFAOYSA-L |
| Molecular Formula | C10H10Cl2Ti-2 |
Isopropyl Alcohol, GR, ACS, MilliporeSigma™
CAS: 67-63-0 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.096 InChI Key: KFZMGEQAYNKOFK-UHFFFAOYSA-N Synonym: isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol PubChem CID: 3776 ChEBI: CHEBI:17824 IUPAC Name: propan-2-ol SMILES: CC(C)O
| PubChem CID | 3776 |
|---|---|
| CAS | 67-63-0 |
| Molecular Weight (g/mol) | 60.096 |
| ChEBI | CHEBI:17824 |
| SMILES | CC(C)O |
| Synonym | isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol |
| IUPAC Name | propan-2-ol |
| InChI Key | KFZMGEQAYNKOFK-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
Benzyl ethyl malonate, tech. 85%
CAS: 42998-51-6 Molecular Formula: C12H14O4 Molecular Weight (g/mol): 222.24 MDL Number: MFCD00009194 InChI Key: CGNOCUSLPSCMLL-UHFFFAOYSA-N Synonym: benzyl ethyl malonate,benzylethyl malonate,malonic acid benzyl ethyl ester,ethyl benzylmalonate,acmc-20alpf,1-benzyl 3-ethyl malonate #,ethyl phenylmethyl propanedioate,1-benzyl 3-ethyl propanedioate,malonic acid 1-benzyl 3-ethyl ester,ethyl phenylmethyl propane-1,3-dioate PubChem CID: 562228 SMILES: CCOC(=O)CC(=O)OCC1=CC=CC=C1
| PubChem CID | 562228 |
|---|---|
| CAS | 42998-51-6 |
| Molecular Weight (g/mol) | 222.24 |
| MDL Number | MFCD00009194 |
| SMILES | CCOC(=O)CC(=O)OCC1=CC=CC=C1 |
| Synonym | benzyl ethyl malonate,benzylethyl malonate,malonic acid benzyl ethyl ester,ethyl benzylmalonate,acmc-20alpf,1-benzyl 3-ethyl malonate #,ethyl phenylmethyl propanedioate,1-benzyl 3-ethyl propanedioate,malonic acid 1-benzyl 3-ethyl ester,ethyl phenylmethyl propane-1,3-dioate |
| InChI Key | CGNOCUSLPSCMLL-UHFFFAOYSA-N |
| Molecular Formula | C12H14O4 |
3-Furoic acid, 99%
CAS: 488-93-7 Molecular Formula: C5H4O3 Molecular Weight (g/mol): 112.08 MDL Number: MFCD00005350 InChI Key: IHCCAYCGZOLTEU-UHFFFAOYSA-N Synonym: 3-furoic acid,3-furancarboxylic acid,3-carboxyfuran,3-furanoic acid,unii-88a3s7rg98,3-furoate,3-furans,3-furanoate,pubchem6945,acmc-209kee PubChem CID: 10268 ChEBI: CHEBI:30846 IUPAC Name: furan-3-carboxylic acid SMILES: OC(=O)C1=COC=C1
| PubChem CID | 10268 |
|---|---|
| CAS | 488-93-7 |
| Molecular Weight (g/mol) | 112.08 |
| ChEBI | CHEBI:30846 |
| MDL Number | MFCD00005350 |
| SMILES | OC(=O)C1=COC=C1 |
| Synonym | 3-furoic acid,3-furancarboxylic acid,3-carboxyfuran,3-furanoic acid,unii-88a3s7rg98,3-furoate,3-furans,3-furanoate,pubchem6945,acmc-209kee |
| IUPAC Name | furan-3-carboxylic acid |
| InChI Key | IHCCAYCGZOLTEU-UHFFFAOYSA-N |
| Molecular Formula | C5H4O3 |
Diethyl acetone-1,3-dicarboxylate, 96%
CAS: 105-50-0 Molecular Formula: C9H14O5 Molecular Weight (g/mol): 202.21 MDL Number: MFCD00009200 InChI Key: ZSANYRMTSBBUCA-UHFFFAOYSA-N Synonym: diethyl 1,3-acetonedicarboxylate,diethyl 3-oxoglutarate,1,5-diethyl 3-oxopentanedioate,pentanedioic acid, 3-oxo-, diethyl ester,ethyl acetonedicarboxylate,ethyl 3-oxoglutarate,diethyl acetone-1,3-dicarboxylate,diethyl acetone dicarboxylate,3-oxopentanedioic acid diethyl ester,acetonedicarboxylic acid diethyl ester PubChem CID: 66045 IUPAC Name: diethyl 3-oxopentanedioate SMILES: CCOC(=O)CC(=O)CC(=O)OCC
| PubChem CID | 66045 |
|---|---|
| CAS | 105-50-0 |
| Molecular Weight (g/mol) | 202.21 |
| MDL Number | MFCD00009200 |
| SMILES | CCOC(=O)CC(=O)CC(=O)OCC |
| Synonym | diethyl 1,3-acetonedicarboxylate,diethyl 3-oxoglutarate,1,5-diethyl 3-oxopentanedioate,pentanedioic acid, 3-oxo-, diethyl ester,ethyl acetonedicarboxylate,ethyl 3-oxoglutarate,diethyl acetone-1,3-dicarboxylate,diethyl acetone dicarboxylate,3-oxopentanedioic acid diethyl ester,acetonedicarboxylic acid diethyl ester |
| IUPAC Name | diethyl 3-oxopentanedioate |
| InChI Key | ZSANYRMTSBBUCA-UHFFFAOYSA-N |
| Molecular Formula | C9H14O5 |
Diethyl methylmalonate, 99%
CAS: 609-08-5 Molecular Formula: C8H14O4 Molecular Weight (g/mol): 174.2 MDL Number: MFCD00009162 InChI Key: UPQZOUHVTJNGFK-UHFFFAOYSA-N Synonym: diethyl methylmalonate,methylmalonic acid diethyl ester,diethyl 2-methylmalonate,propanedioic acid, methyl-, diethyl ester,1,3-diethyl 2-methylpropanedioate,diethylmethylmalonate,ethyl methylmalonate,diethyl methylpropanedioate,malonic acid, methyl-, diethyl ester,2-methylmalonic acid diethyl PubChem CID: 11857 IUPAC Name: diethyl 2-methylpropanedioate SMILES: CCOC(=O)C(C)C(=O)OCC
| PubChem CID | 11857 |
|---|---|
| CAS | 609-08-5 |
| Molecular Weight (g/mol) | 174.2 |
| MDL Number | MFCD00009162 |
| SMILES | CCOC(=O)C(C)C(=O)OCC |
| Synonym | diethyl methylmalonate,methylmalonic acid diethyl ester,diethyl 2-methylmalonate,propanedioic acid, methyl-, diethyl ester,1,3-diethyl 2-methylpropanedioate,diethylmethylmalonate,ethyl methylmalonate,diethyl methylpropanedioate,malonic acid, methyl-, diethyl ester,2-methylmalonic acid diethyl |
| IUPAC Name | diethyl 2-methylpropanedioate |
| InChI Key | UPQZOUHVTJNGFK-UHFFFAOYSA-N |
| Molecular Formula | C8H14O4 |
1,3-Diethylbenzene, 97+%
CAS: 141-93-5 Molecular Formula: C10H14 Molecular Weight (g/mol): 134.222 MDL Number: MFCD00009260 InChI Key: AFZZYIJIWUTJFO-UHFFFAOYSA-N Synonym: m-diethylbenzene,benzene, 1,3-diethyl,benzene, m-diethyl,m-ethylethylbenzene,unii-zm2x7i1g8y,zm2x7i1g8y,ethylated benzene,benzene, ethylated,meta-diethylbenzene,polyethylated benzene PubChem CID: 8864 IUPAC Name: 1,3-diethylbenzene SMILES: CCC1=CC(=CC=C1)CC
| PubChem CID | 8864 |
|---|---|
| CAS | 141-93-5 |
| Molecular Weight (g/mol) | 134.222 |
| MDL Number | MFCD00009260 |
| SMILES | CCC1=CC(=CC=C1)CC |
| Synonym | m-diethylbenzene,benzene, 1,3-diethyl,benzene, m-diethyl,m-ethylethylbenzene,unii-zm2x7i1g8y,zm2x7i1g8y,ethylated benzene,benzene, ethylated,meta-diethylbenzene,polyethylated benzene |
| IUPAC Name | 1,3-diethylbenzene |
| InChI Key | AFZZYIJIWUTJFO-UHFFFAOYSA-N |
| Molecular Formula | C10H14 |
Malonic acid, 99%, MP Biomedicals™
CAS: 141-82-2 Molecular Formula: C3H4O4 Molecular Weight (g/mol): 104.061 InChI Key: OFOBLEOULBTSOW-UHFFFAOYSA-N Synonym: malonic acid,dicarboxymethane,carboxyacetic acid,methanedicarboxylic acid,kyselina malonova,usaf ek-695,dicarboxylate,dicarboxylic acid,kyselina malonova czech,propanediolic acid PubChem CID: 867 ChEBI: CHEBI:30794 IUPAC Name: propanedioic acid SMILES: C(C(=O)O)C(=O)O
| PubChem CID | 867 |
|---|---|
| CAS | 141-82-2 |
| Molecular Weight (g/mol) | 104.061 |
| ChEBI | CHEBI:30794 |
| SMILES | C(C(=O)O)C(=O)O |
| Synonym | malonic acid,dicarboxymethane,carboxyacetic acid,methanedicarboxylic acid,kyselina malonova,usaf ek-695,dicarboxylate,dicarboxylic acid,kyselina malonova czech,propanediolic acid |
| IUPAC Name | propanedioic acid |
| InChI Key | OFOBLEOULBTSOW-UHFFFAOYSA-N |
| Molecular Formula | C3H4O4 |
4,5-Dibromo-2-furoic acid, 97%
CAS: 2434-03-9 Molecular Formula: C5H2Br2O3 Molecular Weight (g/mol): 269.88 MDL Number: MFCD00092311 InChI Key: BHUVICYZDBUMIU-UHFFFAOYSA-N Synonym: 4,5-dibromo-2-furoic acid,2,3-dibromofuran-5-carboxylic acid,4,5-dibromo-2-furancarboxylic acid,2-furancarboxylicacid, 4,5-dibromo,2-furancarboxylic acid, 4,5-dibromo,zlchem 604,acmc-209xd1,ksc201e3j,4,5-dibromo-2-furoicacid PubChem CID: 4194832 IUPAC Name: 4,5-dibromofuran-2-carboxylic acid SMILES: C1=C(OC(=C1Br)Br)C(=O)O
| PubChem CID | 4194832 |
|---|---|
| CAS | 2434-03-9 |
| Molecular Weight (g/mol) | 269.88 |
| MDL Number | MFCD00092311 |
| SMILES | C1=C(OC(=C1Br)Br)C(=O)O |
| Synonym | 4,5-dibromo-2-furoic acid,2,3-dibromofuran-5-carboxylic acid,4,5-dibromo-2-furancarboxylic acid,2-furancarboxylicacid, 4,5-dibromo,2-furancarboxylic acid, 4,5-dibromo,zlchem 604,acmc-209xd1,ksc201e3j,4,5-dibromo-2-furoicacid |
| IUPAC Name | 4,5-dibromofuran-2-carboxylic acid |
| InChI Key | BHUVICYZDBUMIU-UHFFFAOYSA-N |
| Molecular Formula | C5H2Br2O3 |
3-Ethyltoluene, 97%
CAS: 620-14-4 Molecular Formula: C9H12 Molecular Weight (g/mol): 120.20 MDL Number: MFCD00009259 InChI Key: ZLCSFXXPPANWQY-UHFFFAOYSA-N Synonym: 3-ethyltoluene,m-ethyltoluene,1-methyl-3-ethylbenzene,benzene, 1-ethyl-3-methyl,m-ethylmethylbenzene,m-methylethylbenzene,toluene, m-ethyl,3-methylethylbenzene,1-ethyl-3-methyl-benzene,unii-737ptd7o7e PubChem CID: 12100 ChEBI: CHEBI:77512 IUPAC Name: 1-ethyl-3-methylbenzene SMILES: CCC1=CC=CC(C)=C1
| PubChem CID | 12100 |
|---|---|
| CAS | 620-14-4 |
| Molecular Weight (g/mol) | 120.20 |
| ChEBI | CHEBI:77512 |
| MDL Number | MFCD00009259 |
| SMILES | CCC1=CC=CC(C)=C1 |
| Synonym | 3-ethyltoluene,m-ethyltoluene,1-methyl-3-ethylbenzene,benzene, 1-ethyl-3-methyl,m-ethylmethylbenzene,m-methylethylbenzene,toluene, m-ethyl,3-methylethylbenzene,1-ethyl-3-methyl-benzene,unii-737ptd7o7e |
| IUPAC Name | 1-ethyl-3-methylbenzene |
| InChI Key | ZLCSFXXPPANWQY-UHFFFAOYSA-N |
| Molecular Formula | C9H12 |
Nitrofurfural Diacetate, British Pharmacopoeia (BP) Reference Standard, MilliporeSigma™ Supelco™
This product is provided as delivered and specified by the issuing Pharmacopoeia. All information provided in support of this product, including SDS and any product information leaflets, has been developed and issued under the Authority of the issuing Pharmacopoeia.
Mesitylene, 97%, pure
CAS: 108-67-8 Molecular Formula: C9H12 Molecular Weight (g/mol): 120.19 MDL Number: MFCD00008538 InChI Key: AUHZEENZYGFFBQ-UHFFFAOYSA-N Synonym: mesitylene,sym-trimethylbenzene,benzene, 1,3,5-trimethyl,fleet-x,trimethylbenzol,3,5-dimethyltoluene,s-trimethylbenzene,hsdb 92,2,4,6-trimethylbenzene,1,3,5-trimethyl-benzene PubChem CID: 7947 ChEBI: CHEBI:34833 IUPAC Name: 1,3,5-trimethylbenzene SMILES: CC1=CC(=CC(=C1)C)C
| PubChem CID | 7947 |
|---|---|
| CAS | 108-67-8 |
| Molecular Weight (g/mol) | 120.19 |
| ChEBI | CHEBI:34833 |
| MDL Number | MFCD00008538 |
| SMILES | CC1=CC(=CC(=C1)C)C |
| Synonym | mesitylene,sym-trimethylbenzene,benzene, 1,3,5-trimethyl,fleet-x,trimethylbenzol,3,5-dimethyltoluene,s-trimethylbenzene,hsdb 92,2,4,6-trimethylbenzene,1,3,5-trimethyl-benzene |
| IUPAC Name | 1,3,5-trimethylbenzene |
| InChI Key | AUHZEENZYGFFBQ-UHFFFAOYSA-N |
| Molecular Formula | C9H12 |
3-(3,4-Dimethoxybenzoyl)propionic acid, 98%
CAS: 5333-34-6 Molecular Formula: C12H13O5 Molecular Weight (g/mol): 237.23 MDL Number: MFCD00033286 InChI Key: BUAYFJKMVBIPKA-UHFFFAOYSA-M Synonym: 4-3,4-dimethoxyphenyl-4-oxobutanoic acid,4-3,4-dimethoxyphenyl-4-oxobutyric acid,3-3,4-dimethoxybenzoyl propionic acid,acmc-20amx3,3-veratroylpropionic acid,ss-3,4-dimethoxybenzoyl-propionsaure,2,3-dimethoxybenzoylpropanoic acid,3,4-dimethoxy-4-oxo-benzenebutanoic acid,benzenebutanoic acid,3,4-dimethoxy-g-oxo,4-3,4-dimethoxyphenyl-4-oxo-butanoic acid PubChem CID: 219390 IUPAC Name: 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid SMILES: COC1=CC=C(C=C1OC)C(=O)CCC([O-])=O
| PubChem CID | 219390 |
|---|---|
| CAS | 5333-34-6 |
| Molecular Weight (g/mol) | 237.23 |
| MDL Number | MFCD00033286 |
| SMILES | COC1=CC=C(C=C1OC)C(=O)CCC([O-])=O |
| Synonym | 4-3,4-dimethoxyphenyl-4-oxobutanoic acid,4-3,4-dimethoxyphenyl-4-oxobutyric acid,3-3,4-dimethoxybenzoyl propionic acid,acmc-20amx3,3-veratroylpropionic acid,ss-3,4-dimethoxybenzoyl-propionsaure,2,3-dimethoxybenzoylpropanoic acid,3,4-dimethoxy-4-oxo-benzenebutanoic acid,benzenebutanoic acid,3,4-dimethoxy-g-oxo,4-3,4-dimethoxyphenyl-4-oxo-butanoic acid |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid |
| InChI Key | BUAYFJKMVBIPKA-UHFFFAOYSA-M |
| Molecular Formula | C12H13O5 |
3',5'-Difluoroacetophenone, 98%, Thermo Scientific™
CAS: 123577-99-1 Molecular Formula: C8H6F2O Molecular Weight (g/mol): 156.13 MDL Number: MFCD00042489 InChI Key: OXJLDNSPGPBDCP-UHFFFAOYSA-N Synonym: 3',5'-difluoroacetophenone,3,5-difluoroacetophenone,1-3,5-difluorophenyl ethanone,1-3,5-difluorophenyl ethan-1-one,ethanone, 1-3,5-difluorophenyl,1-acetyl-3,5-difluorobenzene,1-3,5-difluoro-phenyl-ethanone,pubchem2179,acmc-1cacd,3,5-di-fluoroacetophenone PubChem CID: 518596 IUPAC Name: 1-(3,5-difluorophenyl)ethanone SMILES: CC(=O)C1=CC(F)=CC(F)=C1
| PubChem CID | 518596 |
|---|---|
| CAS | 123577-99-1 |
| Molecular Weight (g/mol) | 156.13 |
| MDL Number | MFCD00042489 |
| SMILES | CC(=O)C1=CC(F)=CC(F)=C1 |
| Synonym | 3',5'-difluoroacetophenone,3,5-difluoroacetophenone,1-3,5-difluorophenyl ethanone,1-3,5-difluorophenyl ethan-1-one,ethanone, 1-3,5-difluorophenyl,1-acetyl-3,5-difluorobenzene,1-3,5-difluoro-phenyl-ethanone,pubchem2179,acmc-1cacd,3,5-di-fluoroacetophenone |
| IUPAC Name | 1-(3,5-difluorophenyl)ethanone |
| InChI Key | OXJLDNSPGPBDCP-UHFFFAOYSA-N |
| Molecular Formula | C8H6F2O |
alpha-Hydroxyacetophenone, 97%
CAS: 582-24-1 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00041829 InChI Key: ZWVHTXAYIKBMEE-UHFFFAOYSA-N Synonym: 2-hydroxyacetophenone,benzoylcarbinol,glycolophenone,phenacyl alcohol,alpha-hydroxyacetophenone,2-hydroxy-1-phenylethan-1-one,ethanone, 2-hydroxy-1-phenyl,methanol, benzoyl,omega-hydroxyacetophenone,acetophenone, 2-hydroxy PubChem CID: 68490 ChEBI: CHEBI:28341 IUPAC Name: 2-hydroxy-1-phenylethanone SMILES: C1=CC=C(C=C1)C(=O)CO
| PubChem CID | 68490 |
|---|---|
| CAS | 582-24-1 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:28341 |
| MDL Number | MFCD00041829 |
| SMILES | C1=CC=C(C=C1)C(=O)CO |
| Synonym | 2-hydroxyacetophenone,benzoylcarbinol,glycolophenone,phenacyl alcohol,alpha-hydroxyacetophenone,2-hydroxy-1-phenylethan-1-one,ethanone, 2-hydroxy-1-phenyl,methanol, benzoyl,omega-hydroxyacetophenone,acetophenone, 2-hydroxy |
| IUPAC Name | 2-hydroxy-1-phenylethanone |
| InChI Key | ZWVHTXAYIKBMEE-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |